C22H32O3 — CID 54034415
[(1S)-1-(2,4b,7,10a-tetramethyl-1-oxo-4a,5,6,8a,9,10-hexahydrophenanthren-2-yl)ethyl] acetate (PubChem CID 54034415) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(1S)-1-(2,4b,7,10a-tetramethyl-1-oxo-4a,5,6,8a,9,10-hexahydrophenanthren-2-yl)ethyl] acetate.
| Compound Name | [(1S)-1-(2,4b,7,10a-tetramethyl-1-oxo-4a,5,6,8a,9,10-hexahydrophenanthren-2-yl)ethyl] acetate |
|---|---|
| PubChem CID | 54034415 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(1S)-1-(2,4b,7,10a-tetramethyl-1-oxo-4a,5,6,8a,9,10-hexahydrophenanthren-2-yl)ethyl] acetate |
| SMILES | CC(=O)O[C@@H](C)C1(C)C=CC2C(C)(CCC3C=C(C)CCC32C)C1=O |
| InChI | InChI=1S/C22H32O3/c1-14-7-10-21(5)17(13-14)8-11-22(6)18(21)9-12-20(4,19(22)24)15(2)25-16(3)23/h9,12-13,15,17-18H,7-8,10-11H2,1-6H3/t15-,17?,18?,20?,21?,22?/m0/s1 |
| InChIKey | LHWUIASQCKXIGY-FISFCSFISA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|