C9H13NO — CID 54035022
(3aR,7R,7aS)-7-methyl-2,3,3a,6,7,7a-hexahydroisoindol-1-one (PubChem CID 54035022) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3aR,7R,7aS)-7-methyl-2,3,3a,6,7,7a-hexahydroisoindol-1-one.
| Compound Name | (3aR,7R,7aS)-7-methyl-2,3,3a,6,7,7a-hexahydroisoindol-1-one |
|---|---|
| PubChem CID | 54035022 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3aR,7R,7aS)-7-methyl-2,3,3a,6,7,7a-hexahydroisoindol-1-one |
| SMILES | C[C@@H]1CC=C[C@H]2CNC(=O)[C@@H]12 |
| InChI | InChI=1S/C9H13NO/c1-6-3-2-4-7-5-10-9(11)8(6)7/h2,4,6-8H,3,5H2,1H3,(H,10,11)/t6-,7+,8+/m1/s1 |
| InChIKey | LIHUVHRHWNBDMU-CSMHCCOUSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|