About 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one
3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 54035584) has the molecular formula C20H19N3O2S
and a molecular weight of 365.46 g/mol. Its IUPAC name is 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 54035584 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)C(=C2Oc3ccccc3N2CC)N(c2ccccc2)C1=S |
| InChI | InChI=1S/C20H19N3O2S/c1-3-21-15-12-8-9-13-16(15)25-19(21)17-18(24)22(4-2)20(26)23(17)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | LISAVHXAMJPZOY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one (CID 54035584) is 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one is CCN1C(=O)C(=C2Oc3ccccc3N2CC)N(c2ccccc2)C1=S.
What is the InChIKey of 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one?
The InChIKey is LISAVHXAMJPZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O2S/c1-3-21-15-12-8-9-13-16(15)25-19(21)17-18(24)22(4-2)20(26)23(17)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3.
What are the key properties of 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one?
3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one has a molecular weight of 365.46 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-(3-ethyl-1,3-benzoxazol-2-ylidene)-1-phenyl-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 54035584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).