C21H34O3Si — CID 54035639
[(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl] propanoate (PubChem CID 54035639) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl] propanoate.
| Compound Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl] propanoate |
|---|---|
| PubChem CID | 54035639 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | [(1R,2S)-2-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclohexyl] propanoate |
| SMILES | CCC(=O)O[C@@H]1CCCC[C@H]1c1ccccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3Si/c1-7-20(22)23-18-14-10-8-12-16(18)17-13-9-11-15-19(17)24-25(5,6)21(2,3)4/h9,11,13,15-16,18H,7-8,10,12,14H2,1-6H3/t16-,18+/m0/s1 |
| InChIKey | LITAGAKOGAIIHM-FUHWJXTLSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|