C12H16F3NO5S — CID 54035957
(4,6-diethyl-1,3-dihydroxy-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl) trifluoromethanesulfonate (PubChem CID 54035957) has the molecular formula C12H16F3NO5S and a molecular weight of 343.32 g/mol. Its IUPAC name is (4,6-diethyl-1,3-dihydroxy-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl) trifluoromethanesulfonate.
| Compound Name | (4,6-diethyl-1,3-dihydroxy-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54035957 |
| Molecular Formula | C12H16F3NO5S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (4,6-diethyl-1,3-dihydroxy-5,6-dihydro-4H-cyclopenta[c]pyrrol-2-yl) trifluoromethanesulfonate |
| SMILES | CCC1CC(CC)c2c1c(O)n(OS(=O)(=O)C(F)(F)F)c2O |
| InChI | InChI=1S/C12H16F3NO5S/c1-3-6-5-7(4-2)9-8(6)10(17)16(11(9)18)21-22(19,20)12(13,14)15/h6-7,17-18H,3-5H2,1-2H3 |
| InChIKey | LIYJGNBMFUNJJE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|