About 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile
2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile (PubChem CID 54036038) has the molecular formula C12H9FN2O2
and a molecular weight of 232.21 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile |
| PubChem CID | 54036038 |
| Molecular Formula | C12H9FN2O2 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile |
| SMILES | N#CCc1cc(O)n(-c2ccc(F)cc2)c1O |
| InChI | InChI=1S/C12H9FN2O2/c13-9-1-3-10(4-2-9)15-11(16)7-8(5-6-14)12(15)17/h1-4,7,16-17H,5H2 |
| InChIKey | LIZYJGFDTMRZLE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile?
The IUPAC name of 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile (CID 54036038) is 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile.
What is the SMILES notation for 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile?
The canonical SMILES for 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile is N#CCc1cc(O)n(-c2ccc(F)cc2)c1O.
What is the InChIKey of 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile?
The InChIKey is LIZYJGFDTMRZLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FN2O2/c13-9-1-3-10(4-2-9)15-11(16)7-8(5-6-14)12(15)17/h1-4,7,16-17H,5H2.
What are the key properties of 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile?
2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile has a molecular weight of 232.21 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-fluorophenyl)-2,5-dihydroxypyrrol-3-yl]acetonitrile is sourced from PubChem (CID 54036038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).