About 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole
5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole (PubChem CID 54036155) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole |
| PubChem CID | 54036155 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole |
| SMILES | C=CCC1C=CC2=C(C1)OCO2 |
| InChI | InChI=1S/C10H12O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2,4-5,8H,1,3,6-7H2 |
| InChIKey | LJBXBDJEEYJBAC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole?
The IUPAC name of 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole (CID 54036155) is 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole.
What is the SMILES notation for 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole?
The canonical SMILES for 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole is C=CCC1C=CC2=C(C1)OCO2.
What is the InChIKey of 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole?
The InChIKey is LJBXBDJEEYJBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-3-8-4-5-9-10(6-8)12-7-11-9/h2,4-5,8H,1,3,6-7H2.
What are the key properties of 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole?
5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole has a molecular weight of 164.20 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-4,5-dihydro-1,3-benzodioxole is sourced from PubChem (CID 54036155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).