About [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid
[2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid (PubChem CID 54036174) has the molecular formula C14H12F3N3O3
and a molecular weight of 327.26 g/mol. Its IUPAC name is [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid.
Molecular Properties
| Compound Name | [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid |
| PubChem CID | 54036174 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid |
| SMILES | Cc1cc(OCC(F)(F)F)nc(-c2ccccc2NC(=O)O)n1 |
| InChI | InChI=1S/C14H12F3N3O3/c1-8-6-11(23-7-14(15,16)17)20-12(18-8)9-4-2-3-5-10(9)19-13(21)22/h2-6,19H,7H2,1H3,(H,21,22) |
| InChIKey | LJCHZGWDEBGANL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid?
The IUPAC name of [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid (CID 54036174) is [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid.
What is the SMILES notation for [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid?
The canonical SMILES for [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid is Cc1cc(OCC(F)(F)F)nc(-c2ccccc2NC(=O)O)n1.
What is the InChIKey of [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid?
The InChIKey is LJCHZGWDEBGANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N3O3/c1-8-6-11(23-7-14(15,16)17)20-12(18-8)9-4-2-3-5-10(9)19-13(21)22/h2-6,19H,7H2,1H3,(H,21,22).
What are the key properties of [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid?
[2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid has a molecular weight of 327.26 g/mol, XLogP of 3.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-methyl-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]phenyl]carbamic acid is sourced from PubChem (CID 54036174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).