C11H3F13O4 — CID 54036213
methyl 2,2,3,3,5,6,6,8,9,9-decafluoro-4,7-dioxo-5-(trifluoromethyl)non-8-enoate (PubChem CID 54036213) has the molecular formula C11H3F13O4 and a molecular weight of 446.12 g/mol. Its IUPAC name is methyl 2,2,3,3,5,6,6,8,9,9-decafluoro-4,7-dioxo-5-(trifluoromethyl)non-8-enoate.
| Compound Name | methyl 2,2,3,3,5,6,6,8,9,9-decafluoro-4,7-dioxo-5-(trifluoromethyl)non-8-enoate |
|---|---|
| PubChem CID | 54036213 |
| Molecular Formula | C11H3F13O4 |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | methyl 2,2,3,3,5,6,6,8,9,9-decafluoro-4,7-dioxo-5-(trifluoromethyl)non-8-enoate |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(=O)C(F)(C(F)(F)F)C(F)(F)C(=O)C(F)=C(F)F |
| InChI | InChI=1S/C11H3F13O4/c1-28-6(27)10(20,21)9(18,19)5(26)7(15,11(22,23)24)8(16,17)3(25)2(12)4(13)14/h1H3 |
| InChIKey | LJDCNEHKHIYQJK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|