C21H31FO5 — CID 54036373
7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxynona-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54036373) has the molecular formula C21H31FO5 and a molecular weight of 382.47 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxynona-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxynona-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54036373 |
| Molecular Formula | C21H31FO5 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxynona-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCCC=C(F)[C@H](O)C=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O |
| InChI | InChI=1S/C21H31FO5/c1-2-3-5-9-17(22)19(24)14-12-15-11-13-18(23)16(15)8-6-4-7-10-20(25)21(26)27/h4,6,9,12,14-16,19-20,24-25H,2-3,5,7-8,10-11,13H2,1H3,(H,26,27)/t15-,16-,19-,20?/m1/s1 |
| InChIKey | LJGGCCTYJUVTBD-OPVIUJQZSA-N |
| XLogP | 3.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|