About 2-(2,2-diaminoethylamino)acetic acid
2-(2,2-diaminoethylamino)acetic acid (PubChem CID 54036519) has the molecular formula C4H11N3O2
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-(2,2-diaminoethylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(2,2-diaminoethylamino)acetic acid |
| PubChem CID | 54036519 |
| Molecular Formula | C4H11N3O2 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 2-(2,2-diaminoethylamino)acetic acid |
| SMILES | NC(N)CNCC(=O)O |
| InChI | InChI=1S/C4H11N3O2/c5-3(6)1-7-2-4(8)9/h3,7H,1-2,5-6H2,(H,8,9) |
| InChIKey | LJINSKIHVMGTDJ-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diaminoethylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diaminoethylamino)acetic acid?
The IUPAC name of 2-(2,2-diaminoethylamino)acetic acid (CID 54036519) is 2-(2,2-diaminoethylamino)acetic acid.
What is the SMILES notation for 2-(2,2-diaminoethylamino)acetic acid?
The canonical SMILES for 2-(2,2-diaminoethylamino)acetic acid is NC(N)CNCC(=O)O.
What is the InChIKey of 2-(2,2-diaminoethylamino)acetic acid?
The InChIKey is LJINSKIHVMGTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O2/c5-3(6)1-7-2-4(8)9/h3,7H,1-2,5-6H2,(H,8,9).
What are the key properties of 2-(2,2-diaminoethylamino)acetic acid?
2-(2,2-diaminoethylamino)acetic acid has a molecular weight of 133.15 g/mol, XLogP of -2.10, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diaminoethylamino)acetic acid is sourced from PubChem (CID 54036519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).