3-(nitromethyl)octanoic acid

C9H17NO4 — CID 54036622

IUPAC3-(nitromethyl)octanoic acid
SMILESCCCCCC(CC(=O)O)C[N+](=O)[O-]
InChIInChI=1S/C9H17NO4/c1-2-3-4-5-8(6-9(11)12)7-10(13)14/h8H,2-7H2,1H3,(H,11,12)
InChIKeyLJKNEOZSGFKUQC-UHFFFAOYSA-N
MW203.24 g/mol
LogP1.93
Rot. Bonds8

About 3-(nitromethyl)octanoic acid

3-(nitromethyl)octanoic acid (PubChem CID 54036622) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(nitromethyl)octanoic acid.

Molecular Properties

Compound Name3-(nitromethyl)octanoic acid
PubChem CID54036622
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Name3-(nitromethyl)octanoic acid
SMILESCCCCCC(CC(=O)O)C[N+](=O)[O-]
InChIInChI=1S/C9H17NO4/c1-2-3-4-5-8(6-9(11)12)7-10(13)14/h8H,2-7H2,1H3,(H,11,12)
InChIKeyLJKNEOZSGFKUQC-UHFFFAOYSA-N
XLogP1.93
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 51.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-(nitromethyl)octanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(nitromethyl)octanoic acid?
The IUPAC name of 3-(nitromethyl)octanoic acid (CID 54036622) is 3-(nitromethyl)octanoic acid.
What is the SMILES notation for 3-(nitromethyl)octanoic acid?
The canonical SMILES for 3-(nitromethyl)octanoic acid is CCCCCC(CC(=O)O)C[N+](=O)[O-].
What is the InChIKey of 3-(nitromethyl)octanoic acid?
The InChIKey is LJKNEOZSGFKUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-2-3-4-5-8(6-9(11)12)7-10(13)14/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-(nitromethyl)octanoic acid?
3-(nitromethyl)octanoic acid has a molecular weight of 203.24 g/mol, XLogP of 1.93, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)octanoic acid is sourced from PubChem (CID 54036622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).