About 3-(nitromethyl)octanoic acid
3-(nitromethyl)octanoic acid (PubChem CID 54036622) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(nitromethyl)octanoic acid.
Molecular Properties
| Compound Name | 3-(nitromethyl)octanoic acid |
| PubChem CID | 54036622 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-(nitromethyl)octanoic acid |
| SMILES | CCCCCC(CC(=O)O)C[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-2-3-4-5-8(6-9(11)12)7-10(13)14/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | LJKNEOZSGFKUQC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(nitromethyl)octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(nitromethyl)octanoic acid?
The IUPAC name of 3-(nitromethyl)octanoic acid (CID 54036622) is 3-(nitromethyl)octanoic acid.
What is the SMILES notation for 3-(nitromethyl)octanoic acid?
The canonical SMILES for 3-(nitromethyl)octanoic acid is CCCCCC(CC(=O)O)C[N+](=O)[O-].
What is the InChIKey of 3-(nitromethyl)octanoic acid?
The InChIKey is LJKNEOZSGFKUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-2-3-4-5-8(6-9(11)12)7-10(13)14/h8H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-(nitromethyl)octanoic acid?
3-(nitromethyl)octanoic acid has a molecular weight of 203.24 g/mol, XLogP of 1.93, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(nitromethyl)octanoic acid is sourced from PubChem (CID 54036622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).