About [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate
[(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate (PubChem CID 54036674) has the molecular formula C12H19NO4S
and a molecular weight of 273.35 g/mol. Its IUPAC name is [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate |
| PubChem CID | 54036674 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate |
| SMILES | C=CCC1(CC=C)C[C@@H](COS(C)(=O)=O)NC1=O |
| InChI | InChI=1S/C12H19NO4S/c1-4-6-12(7-5-2)8-10(13-11(12)14)9-17-18(3,15)16/h4-5,10H,1-2,6-9H2,3H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | LJLLKFPRDCNOCH-JTQLQIEISA-N |
| XLogP | 0.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate?
The IUPAC name of [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate (CID 54036674) is [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate.
What is the SMILES notation for [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate?
The canonical SMILES for [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate is C=CCC1(CC=C)C[C@@H](COS(C)(=O)=O)NC1=O.
What is the InChIKey of [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate?
The InChIKey is LJLLKFPRDCNOCH-JTQLQIEISA-N. The full InChI is InChI=1S/C12H19NO4S/c1-4-6-12(7-5-2)8-10(13-11(12)14)9-17-18(3,15)16/h4-5,10H,1-2,6-9H2,3H3,(H,13,14)/t10-/m0/s1.
What are the key properties of [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate?
[(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate has a molecular weight of 273.35 g/mol, XLogP of 0.99, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5-oxo-4,4-bis(prop-2-enyl)pyrrolidin-2-yl]methyl methanesulfonate is sourced from PubChem (CID 54036674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).