C23H40N2O14 — CID 54037099
methyl 6-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyethylamino]-6-oxohexanoate (PubChem CID 54037099) has the molecular formula C23H40N2O14 and a molecular weight of 568.57 g/mol. Its IUPAC name is methyl 6-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyethylamino]-6-oxohexanoate.
| Compound Name | methyl 6-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyethylamino]-6-oxohexanoate |
|---|---|
| PubChem CID | 54037099 |
| Molecular Formula | C23H40N2O14 |
| Molecular Weight | 568.57 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | methyl 6-[2-[(2S,3R,4R,5R,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxyethylamino]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)NCCO[C@H]1O[C@H](CO)[C@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H40N2O14/c1-11(28)25-16-18(32)21(39-23-20(34)19(33)17(31)12(9-26)37-23)13(10-27)38-22(16)36-8-7-24-14(29)5-3-4-6-15(30)35-2/h12-13,16-23,26-27,31-34H,3-10H2,1-2H3,(H,24,29)(H,25,28)/t12-,13-,16-,17+,18-,19+,20-,21+,22+,23+/m1/s1 |
| InChIKey | LJSQYIZLKMPLMS-QTOHBSSYSA-N |
| XLogP | -4.38 |
| TPSA | 242.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.57 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|