C30H62O12 — CID 54037318
1,2,3,4,5,6-hexakis(2-ethoxyethoxy)hexane (PubChem CID 54037318) has the molecular formula C30H62O12 and a molecular weight of 614.81 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis(2-ethoxyethoxy)hexane.
| Compound Name | 1,2,3,4,5,6-hexakis(2-ethoxyethoxy)hexane |
|---|---|
| PubChem CID | 54037318 |
| Molecular Formula | C30H62O12 |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | 1,2,3,4,5,6-hexakis(2-ethoxyethoxy)hexane |
| SMILES | CCOCCOCC(OCCOCC)C(OCCOCC)C(OCCOCC)C(COCCOCC)OCCOCC |
| InChI | InChI=1S/C30H62O12/c1-7-31-13-15-37-25-27(39-21-17-33-9-3)29(41-23-19-35-11-5)30(42-24-20-36-12-6)28(40-22-18-34-10-4)26-38-16-14-32-8-2/h27-30H,7-26H2,1-6H3 |
| InChIKey | LJWIWQFBOGKKHG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|