About bis(3-methylbutyl) thiolane-2,5-dicarboxylate
bis(3-methylbutyl) thiolane-2,5-dicarboxylate (PubChem CID 54037380) has the molecular formula C16H28O4S
and a molecular weight of 316.46 g/mol. Its IUPAC name is bis(3-methylbutyl) thiolane-2,5-dicarboxylate.
Molecular Properties
| Compound Name | bis(3-methylbutyl) thiolane-2,5-dicarboxylate |
| PubChem CID | 54037380 |
| Molecular Formula | C16H28O4S |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | bis(3-methylbutyl) thiolane-2,5-dicarboxylate |
| SMILES | CC(C)CCOC(=O)C1CCC(C(=O)OCCC(C)C)S1 |
| InChI | InChI=1S/C16H28O4S/c1-11(2)7-9-19-15(17)13-5-6-14(21-13)16(18)20-10-8-12(3)4/h11-14H,5-10H2,1-4H3 |
| InChIKey | LJXOQYUITDSUQB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(3-methylbutyl) thiolane-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylbutyl) thiolane-2,5-dicarboxylate?
The IUPAC name of bis(3-methylbutyl) thiolane-2,5-dicarboxylate (CID 54037380) is bis(3-methylbutyl) thiolane-2,5-dicarboxylate.
What is the SMILES notation for bis(3-methylbutyl) thiolane-2,5-dicarboxylate?
The canonical SMILES for bis(3-methylbutyl) thiolane-2,5-dicarboxylate is CC(C)CCOC(=O)C1CCC(C(=O)OCCC(C)C)S1.
What is the InChIKey of bis(3-methylbutyl) thiolane-2,5-dicarboxylate?
The InChIKey is LJXOQYUITDSUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O4S/c1-11(2)7-9-19-15(17)13-5-6-14(21-13)16(18)20-10-8-12(3)4/h11-14H,5-10H2,1-4H3.
What are the key properties of bis(3-methylbutyl) thiolane-2,5-dicarboxylate?
bis(3-methylbutyl) thiolane-2,5-dicarboxylate has a molecular weight of 316.46 g/mol, XLogP of 3.43, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylbutyl) thiolane-2,5-dicarboxylate is sourced from PubChem (CID 54037380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).