C16H15FN2O4 — CID 54037454
5-acetyl-1-but-3-en-2-yl-3-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 54037454) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-acetyl-1-but-3-en-2-yl-3-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-acetyl-1-but-3-en-2-yl-3-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54037454 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-acetyl-1-but-3-en-2-yl-3-(4-fluorophenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | C=CC(C)n1c(O)c(C(C)=O)c(=O)n(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C16H15FN2O4/c1-4-9(2)18-14(21)13(10(3)20)15(22)19(16(18)23)12-7-5-11(17)6-8-12/h4-9,21H,1H2,2-3H3 |
| InChIKey | RWDVIUBKYCKZAR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|