C25H42 — CID 54038211
(9E)-2,6,11,15,19-pentamethylicosa-2,6,9,14,18-pentaene (PubChem CID 54038211) has the molecular formula C25H42 and a molecular weight of 342.61 g/mol. Its IUPAC name is (9E)-2,6,11,15,19-pentamethylicosa-2,6,9,14,18-pentaene.
| Compound Name | (9E)-2,6,11,15,19-pentamethylicosa-2,6,9,14,18-pentaene |
|---|---|
| PubChem CID | 54038211 |
| Molecular Formula | C25H42 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | (9E)-2,6,11,15,19-pentamethylicosa-2,6,9,14,18-pentaene |
| SMILES | CC(C)=CCCC(C)=CC/C=C/C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H42/c1-21(2)13-10-17-23(5)15-8-9-16-24(6)19-12-20-25(7)18-11-14-22(3)4/h9,13-16,20,24H,8,10-12,17-19H2,1-7H3/b16-9+,23-15?,25-20? |
| InChIKey | QPNRRRPNMZPKMI-GFLHFYMPSA-N |
| XLogP | 8.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|