C9H12F3NO4S — CID 54038696
(2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]propanoic acid (PubChem CID 54038696) has the molecular formula C9H12F3NO4S and a molecular weight of 287.26 g/mol. Its IUPAC name is (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54038696 |
| Molecular Formula | C9H12F3NO4S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | (2S)-2-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]propanoic acid |
| SMILES | CC(=O)SCC(C(=O)N[C@@H](C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO4S/c1-4(8(16)17)13-7(15)6(9(10,11)12)3-18-5(2)14/h4,6H,3H2,1-2H3,(H,13,15)(H,16,17)/t4-,6?/m0/s1 |
| InChIKey | LKUFOLDDUDRYEL-VKZKZBKNSA-N |
| XLogP | 1.03 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|