About 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol
2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol (PubChem CID 54039052) has the molecular formula C18H11Br4O3P
and a molecular weight of 625.87 g/mol. Its IUPAC name is 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol.
Molecular Properties
| Compound Name | 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol |
| PubChem CID | 54039052 |
| Molecular Formula | C18H11Br4O3P |
| Molecular Weight | 625.87 g/mol |
| Exact Mass | 621.72 |
| IUPAC Name | 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol |
| SMILES | O=P(c1ccccc1)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C18H11Br4O3P/c19-13-6-11(7-14(20)17(13)23)26(25,10-4-2-1-3-5-10)12-8-15(21)18(24)16(22)9-12/h1-9,23-24H |
| InChIKey | LLARTCSTTUKQSG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 625.87 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol?
The IUPAC name of 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol (CID 54039052) is 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol.
What is the SMILES notation for 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol?
The canonical SMILES for 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol is O=P(c1ccccc1)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1.
What is the InChIKey of 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol?
The InChIKey is LLARTCSTTUKQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Br4O3P/c19-13-6-11(7-14(20)17(13)23)26(25,10-4-2-1-3-5-10)12-8-15(21)18(24)16(22)9-12/h1-9,23-24H.
What are the key properties of 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol?
2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol has a molecular weight of 625.87 g/mol, XLogP of 5.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylphosphoryl]phenol is sourced from PubChem (CID 54039052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).