About 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate
3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate (PubChem CID 54039379) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate.
Molecular Properties
| Compound Name | 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate |
| PubChem CID | 54039379 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate |
| SMILES | CC(C)(C)CC(=O)OOOOC(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H22O6/c1-11(2,3)7-9(13)15-17-18-16-10(14)8-12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | LLGOHTKIAXDNHM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate?
The IUPAC name of 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate (CID 54039379) is 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate.
What is the SMILES notation for 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate?
The canonical SMILES for 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate is CC(C)(C)CC(=O)OOOOC(=O)CC(C)(C)C.
What is the InChIKey of 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate?
The InChIKey is LLGOHTKIAXDNHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6/c1-11(2,3)7-9(13)15-17-18-16-10(14)8-12(4,5)6/h7-8H2,1-6H3.
What are the key properties of 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate?
3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate has a molecular weight of 262.30 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutanoylperoxy 3,3-dimethylbutaneperoxoate is sourced from PubChem (CID 54039379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).