C24H37NO4 — CID 54039417
(2S,3R)-3-hydroxy-2-(icosa-2,4,6,8,10-pentaenoylamino)butanoic acid (PubChem CID 54039417) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-(icosa-2,4,6,8,10-pentaenoylamino)butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-(icosa-2,4,6,8,10-pentaenoylamino)butanoic acid |
|---|---|
| PubChem CID | 54039417 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-(icosa-2,4,6,8,10-pentaenoylamino)butanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C24H37NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(27)25-23(21(2)26)24(28)29/h11-21,23,26H,3-10H2,1-2H3,(H,25,27)(H,28,29)/t21-,23+/m1/s1 |
| InChIKey | LLHBYGLOXNBBJC-GGAORHGYSA-N |
| XLogP | 4.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|