About 5-methoxy-4,8-dimethylnon-3-ene
5-methoxy-4,8-dimethylnon-3-ene (PubChem CID 54039577) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 5-methoxy-4,8-dimethylnon-3-ene.
Molecular Properties
| Compound Name | 5-methoxy-4,8-dimethylnon-3-ene |
| PubChem CID | 54039577 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 5-methoxy-4,8-dimethylnon-3-ene |
| SMILES | CCC=C(C)C(CCC(C)C)OC |
| InChI | InChI=1S/C12H24O/c1-6-7-11(4)12(13-5)9-8-10(2)3/h7,10,12H,6,8-9H2,1-5H3 |
| InChIKey | LLJYLFYNMBCXDG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4,8-dimethylnon-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4,8-dimethylnon-3-ene?
The IUPAC name of 5-methoxy-4,8-dimethylnon-3-ene (CID 54039577) is 5-methoxy-4,8-dimethylnon-3-ene.
What is the SMILES notation for 5-methoxy-4,8-dimethylnon-3-ene?
The canonical SMILES for 5-methoxy-4,8-dimethylnon-3-ene is CCC=C(C)C(CCC(C)C)OC.
What is the InChIKey of 5-methoxy-4,8-dimethylnon-3-ene?
The InChIKey is LLJYLFYNMBCXDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-6-7-11(4)12(13-5)9-8-10(2)3/h7,10,12H,6,8-9H2,1-5H3.
What are the key properties of 5-methoxy-4,8-dimethylnon-3-ene?
5-methoxy-4,8-dimethylnon-3-ene has a molecular weight of 184.32 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4,8-dimethylnon-3-ene is sourced from PubChem (CID 54039577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).