About 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid
2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid (PubChem CID 54039760) has the molecular formula C9H6ClNO3S2
and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid.
Molecular Properties
| Compound Name | 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid |
| PubChem CID | 54039760 |
| Molecular Formula | C9H6ClNO3S2 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid |
| SMILES | CON=C(C(=O)O)c1cc2sc(Cl)cc2s1 |
| InChI | InChI=1S/C9H6ClNO3S2/c1-14-11-8(9(12)13)6-2-4-5(15-6)3-7(10)16-4/h2-3H,1H3,(H,12,13) |
| InChIKey | LLMSJNWNAMSBFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid?
The IUPAC name of 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid (CID 54039760) is 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid.
What is the SMILES notation for 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid?
The canonical SMILES for 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid is CON=C(C(=O)O)c1cc2sc(Cl)cc2s1.
What is the InChIKey of 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid?
The InChIKey is LLMSJNWNAMSBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO3S2/c1-14-11-8(9(12)13)6-2-4-5(15-6)3-7(10)16-4/h2-3H,1H3,(H,12,13).
What are the key properties of 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid?
2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid has a molecular weight of 275.74 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chlorothieno[3,2-b]thiophen-2-yl)-2-methoxyiminoacetic acid is sourced from PubChem (CID 54039760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).