C44H43N5O5 — CID 54039809
2-[2-[methyl-(11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-15-yl)amino]ethoxycarbonylamino]ethyl 4-carbazol-9-yl-2-ethyl-2-methylpentanoate (PubChem CID 54039809) has the molecular formula C44H43N5O5 and a molecular weight of 721.86 g/mol. Its IUPAC name is 2-[2-[methyl-(11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-15-yl)amino]ethoxycarbonylamino]ethyl 4-carbazol-9-yl-2-ethyl-2-methylpentanoate.
| Compound Name | 2-[2-[methyl-(11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-15-yl)amino]ethoxycarbonylamino]ethyl 4-carbazol-9-yl-2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 54039809 |
| Molecular Formula | C44H43N5O5 |
| Molecular Weight | 721.86 g/mol |
| Exact Mass | 721.33 |
| IUPAC Name | 2-[2-[methyl-(11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaen-15-yl)amino]ethoxycarbonylamino]ethyl 4-carbazol-9-yl-2-ethyl-2-methylpentanoate |
| SMILES | CCC(C)(CC(C)n1c2ccccc2c2ccccc21)C(=O)OCCNC(=O)OCCN(C)c1ccc2c(=O)n3c4ccccc4nc3c3cccc1c23 |
| InChI | InChI=1S/C44H43N5O5/c1-5-44(3,27-28(2)48-36-18-9-6-13-29(36)30-14-7-10-19-37(30)48)42(51)53-25-23-45-43(52)54-26-24-47(4)35-22-21-33-39-31(35)15-12-16-32(39)40-46-34-17-8-11-20-38(34)49(40)41(33)50/h6-22,28H,5,23-27H2,1-4H3,(H,45,52) |
| InChIKey | LLNMQUURIGHMGO-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.86 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|