C8H7Cl4NS2 — CID 54039898
4-methyl-2-(1,1,2,2-tetrachloroethyldisulfanyl)pyridine (PubChem CID 54039898) has the molecular formula C8H7Cl4NS2 and a molecular weight of 323.10 g/mol. Its IUPAC name is 4-methyl-2-(1,1,2,2-tetrachloroethyldisulfanyl)pyridine.
| Compound Name | 4-methyl-2-(1,1,2,2-tetrachloroethyldisulfanyl)pyridine |
|---|---|
| PubChem CID | 54039898 |
| Molecular Formula | C8H7Cl4NS2 |
| Molecular Weight | 323.10 g/mol |
| Exact Mass | 320.88 |
| IUPAC Name | 4-methyl-2-(1,1,2,2-tetrachloroethyldisulfanyl)pyridine |
| SMILES | Cc1ccnc(SSC(Cl)(Cl)C(Cl)Cl)c1 |
| InChI | InChI=1S/C8H7Cl4NS2/c1-5-2-3-13-6(4-5)14-15-8(11,12)7(9)10/h2-4,7H,1H3 |
| InChIKey | LLOUQVOXCDZAQR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.10 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|