C8H9NO8S2 — CID 54039935
1-(3-nitrophenyl)ethane-1,2-disulfonic acid (PubChem CID 54039935) has the molecular formula C8H9NO8S2 and a molecular weight of 311.29 g/mol. Its IUPAC name is 1-(3-nitrophenyl)ethane-1,2-disulfonic acid.
| Compound Name | 1-(3-nitrophenyl)ethane-1,2-disulfonic acid |
|---|---|
| PubChem CID | 54039935 |
| Molecular Formula | C8H9NO8S2 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 1-(3-nitrophenyl)ethane-1,2-disulfonic acid |
| SMILES | O=[N+]([O-])c1cccc(C(CS(=O)(=O)O)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H9NO8S2/c10-9(11)7-3-1-2-6(4-7)8(19(15,16)17)5-18(12,13)14/h1-4,8H,5H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | LLPOORRRPWPGIC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|