About N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide
N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide (PubChem CID 54040170) has the molecular formula C30H35NO2
and a molecular weight of 441.62 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide |
| PubChem CID | 54040170 |
| Molecular Formula | C30H35NO2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCCOc1cccc(C=CC(=O)NC(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C30H35NO2/c1-2-3-4-5-12-22-33-28-19-13-16-26(23-28)20-21-30(32)31-29(27-17-10-7-11-18-27)24-25-14-8-6-9-15-25/h6-11,13-21,23,29H,2-5,12,22,24H2,1H3,(H,31,32) |
| InChIKey | LLTJCMXTANSXML-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide?
The IUPAC name of N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide (CID 54040170) is N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide.
What is the SMILES notation for N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide?
The canonical SMILES for N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide is CCCCCCCOc1cccc(C=CC(=O)NC(Cc2ccccc2)c2ccccc2)c1.
What is the InChIKey of N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide?
The InChIKey is LLTJCMXTANSXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H35NO2/c1-2-3-4-5-12-22-33-28-19-13-16-26(23-28)20-21-30(32)31-29(27-17-10-7-11-18-27)24-25-14-8-6-9-15-25/h6-11,13-21,23,29H,2-5,12,22,24H2,1H3,(H,31,32).
What are the key properties of N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide?
N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide has a molecular weight of 441.62 g/mol, XLogP of 7.15, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-diphenylethyl)-3-(3-heptoxyphenyl)prop-2-enamide is sourced from PubChem (CID 54040170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).