About 8-cyclohexyloct-5-enyl methanesulfonate
8-cyclohexyloct-5-enyl methanesulfonate (PubChem CID 54040425) has the molecular formula C15H28O3S
and a molecular weight of 288.45 g/mol. Its IUPAC name is 8-cyclohexyloct-5-enyl methanesulfonate.
Molecular Properties
| Compound Name | 8-cyclohexyloct-5-enyl methanesulfonate |
| PubChem CID | 54040425 |
| Molecular Formula | C15H28O3S |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 8-cyclohexyloct-5-enyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCC=CCCC1CCCCC1 |
| InChI | InChI=1S/C15H28O3S/c1-19(16,17)18-14-10-5-3-2-4-7-11-15-12-8-6-9-13-15/h2,4,15H,3,5-14H2,1H3 |
| InChIKey | LLXRKXKBVIPWBC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 8-cyclohexyloct-5-enyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclohexyloct-5-enyl methanesulfonate?
The IUPAC name of 8-cyclohexyloct-5-enyl methanesulfonate (CID 54040425) is 8-cyclohexyloct-5-enyl methanesulfonate.
What is the SMILES notation for 8-cyclohexyloct-5-enyl methanesulfonate?
The canonical SMILES for 8-cyclohexyloct-5-enyl methanesulfonate is CS(=O)(=O)OCCCCC=CCCC1CCCCC1.
What is the InChIKey of 8-cyclohexyloct-5-enyl methanesulfonate?
The InChIKey is LLXRKXKBVIPWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3S/c1-19(16,17)18-14-10-5-3-2-4-7-11-15-12-8-6-9-13-15/h2,4,15H,3,5-14H2,1H3.
What are the key properties of 8-cyclohexyloct-5-enyl methanesulfonate?
8-cyclohexyloct-5-enyl methanesulfonate has a molecular weight of 288.45 g/mol, XLogP of 4.05, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclohexyloct-5-enyl methanesulfonate is sourced from PubChem (CID 54040425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).