C11H13ClN4O5 — CID 54040668
(2R,3R,4R)-1-(6-chloropurin-9-yl)-3,4,5-trihydroxy-2-methoxypentan-1-one (PubChem CID 54040668) has the molecular formula C11H13ClN4O5 and a molecular weight of 316.70 g/mol. Its IUPAC name is (2R,3R,4R)-1-(6-chloropurin-9-yl)-3,4,5-trihydroxy-2-methoxypentan-1-one.
| Compound Name | (2R,3R,4R)-1-(6-chloropurin-9-yl)-3,4,5-trihydroxy-2-methoxypentan-1-one |
|---|---|
| PubChem CID | 54040668 |
| Molecular Formula | C11H13ClN4O5 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (2R,3R,4R)-1-(6-chloropurin-9-yl)-3,4,5-trihydroxy-2-methoxypentan-1-one |
| SMILES | CO[C@@H](C(=O)n1cnc2c(Cl)ncnc21)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H13ClN4O5/c1-21-8(7(19)5(18)2-17)11(20)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,17-19H,2H2,1H3/t5-,7-,8-/m1/s1 |
| InChIKey | LMBZQOLGMPXJSW-LPBLVHEISA-N |
| XLogP | -1.15 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |