About [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane
[4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane (PubChem CID 54040837) has the molecular formula C19H19N2O3P
and a molecular weight of 354.35 g/mol. Its IUPAC name is [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane.
Molecular Properties
| Compound Name | [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane |
| PubChem CID | 54040837 |
| Molecular Formula | C19H19N2O3P |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane |
| SMILES | COc1ccc(-c2nnc(P)c(OC)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19N2O3P/c1-22-14-8-4-12(5-9-14)16-17(20-21-19(25)18(16)24-3)13-6-10-15(23-2)11-7-13/h4-11H,25H2,1-3H3 |
| InChIKey | LMFIMUFYHSTNEZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane?
The IUPAC name of [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane (CID 54040837) is [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane.
What is the SMILES notation for [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane?
The canonical SMILES for [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane is COc1ccc(-c2nnc(P)c(OC)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane?
The InChIKey is LMFIMUFYHSTNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N2O3P/c1-22-14-8-4-12(5-9-14)16-17(20-21-19(25)18(16)24-3)13-6-10-15(23-2)11-7-13/h4-11H,25H2,1-3H3.
What are the key properties of [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane?
[4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane has a molecular weight of 354.35 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane is sourced from PubChem (CID 54040837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).