C19H19N2O3P — CID 54040837
[4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane (PubChem CID 54040837) has the molecular formula C19H19N2O3P and a molecular weight of 354.35 g/mol. Its IUPAC name is [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane.
| Compound Name | [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane |
|---|---|
| PubChem CID | 54040837 |
| Molecular Formula | C19H19N2O3P |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [4-methoxy-5,6-bis(4-methoxyphenyl)pyridazin-3-yl]phosphane |
| SMILES | COc1ccc(-c2nnc(P)c(OC)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H19N2O3P/c1-22-14-8-4-12(5-9-14)16-17(20-21-19(25)18(16)24-3)13-6-10-15(23-2)11-7-13/h4-11H,25H2,1-3H3 |
| InChIKey | LMFIMUFYHSTNEZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|