About ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide
ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide (PubChem CID 54040968) has the molecular formula C21H47NO2
and a molecular weight of 345.61 g/mol. Its IUPAC name is ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide |
| PubChem CID | 54040968 |
| Molecular Formula | C21H47NO2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 345.36 |
| IUPAC Name | ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide |
| SMILES | CC.CC.CCC(CC)C(C)N(CC)C(=O)C(C)C(CO)C(C)C |
| InChI | InChI=1S/C17H35NO2.2C2H6/c1-8-15(9-2)14(7)18(10-3)17(20)13(6)16(11-19)12(4)5;2*1-2/h12-16,19H,8-11H2,1-7H3;2*1-2H3 |
| InChIKey | LMHRYCKMEBNYRY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide?
The IUPAC name of ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide (CID 54040968) is ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide.
What is the SMILES notation for ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide?
The canonical SMILES for ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide is CC.CC.CCC(CC)C(C)N(CC)C(=O)C(C)C(CO)C(C)C.
What is the InChIKey of ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide?
The InChIKey is LMHRYCKMEBNYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2.2C2H6/c1-8-15(9-2)14(7)18(10-3)17(20)13(6)16(11-19)12(4)5;2*1-2/h12-16,19H,8-11H2,1-7H3;2*1-2H3.
What are the key properties of ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide?
ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide has a molecular weight of 345.61 g/mol, XLogP of 5.61, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-(3-ethylpentan-2-yl)-3-(hydroxymethyl)-2,4-dimethylpentanamide is sourced from PubChem (CID 54040968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).