About 3-(oxan-2-yloxy)icosa-11,14-dienal
3-(oxan-2-yloxy)icosa-11,14-dienal (PubChem CID 54041405) has the molecular formula C25H44O3
and a molecular weight of 392.62 g/mol. Its IUPAC name is 3-(oxan-2-yloxy)icosa-11,14-dienal.
Molecular Properties
| Compound Name | 3-(oxan-2-yloxy)icosa-11,14-dienal |
| PubChem CID | 54041405 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 3-(oxan-2-yloxy)icosa-11,14-dienal |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CC=O)OC1CCCCO1 |
| InChI | InChI=1S/C25H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24(21-22-26)28-25-20-17-18-23-27-25/h6-7,9-10,22,24-25H,2-5,8,11-21,23H2,1H3 |
| InChIKey | LMPHFAYRFUESCS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(oxan-2-yloxy)icosa-11,14-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-2-yloxy)icosa-11,14-dienal?
The IUPAC name of 3-(oxan-2-yloxy)icosa-11,14-dienal (CID 54041405) is 3-(oxan-2-yloxy)icosa-11,14-dienal.
What is the SMILES notation for 3-(oxan-2-yloxy)icosa-11,14-dienal?
The canonical SMILES for 3-(oxan-2-yloxy)icosa-11,14-dienal is CCCCCC=CCC=CCCCCCCCC(CC=O)OC1CCCCO1.
What is the InChIKey of 3-(oxan-2-yloxy)icosa-11,14-dienal?
The InChIKey is LMPHFAYRFUESCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24(21-22-26)28-25-20-17-18-23-27-25/h6-7,9-10,22,24-25H,2-5,8,11-21,23H2,1H3.
What are the key properties of 3-(oxan-2-yloxy)icosa-11,14-dienal?
3-(oxan-2-yloxy)icosa-11,14-dienal has a molecular weight of 392.62 g/mol, XLogP of 7.30, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-2-yloxy)icosa-11,14-dienal is sourced from PubChem (CID 54041405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).