C22H26FNO2 — CID 54041408
7-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-6-fluoro-3-methylocta-2,4,6-trienoic acid (PubChem CID 54041408) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 7-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-6-fluoro-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-6-fluoro-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54041408 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 7-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-6-fluoro-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(C=CC(F)=C(C)c1ccc2c(c1)c(C)c(C)n2C(C)C)=CC(=O)O |
| InChI | InChI=1S/C22H26FNO2/c1-13(2)24-17(6)15(4)19-12-18(8-10-21(19)24)16(5)20(23)9-7-14(3)11-22(25)26/h7-13H,1-6H3,(H,25,26) |
| InChIKey | LMPHYDMNLZUXIF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|