C11H22N3O4PS3 — CID 54041413
methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanylcarbamoyloxy]ethanimidothioate (PubChem CID 54041413) has the molecular formula C11H22N3O4PS3 and a molecular weight of 387.49 g/mol. Its IUPAC name is methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanylcarbamoyloxy]ethanimidothioate.
| Compound Name | methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanylcarbamoyloxy]ethanimidothioate |
|---|---|
| PubChem CID | 54041413 |
| Molecular Formula | C11H22N3O4PS3 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | methyl N-[[(5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-yl)-ethylamino]sulfanylcarbamoyloxy]ethanimidothioate |
| SMILES | CCN(SNC(=O)ON=C(C)SC)P1(=S)OCC(C)(C)CO1 |
| InChI | InChI=1S/C11H22N3O4PS3/c1-6-14(19(20)16-7-11(3,4)8-17-19)22-13-10(15)18-12-9(2)21-5/h6-8H2,1-5H3,(H,13,15) |
| InChIKey | LMPJQVRBQLWTII-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|