C18H28FN3O2 — CID 54041770
6-(fluoromethyl)-2,3-bis[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine (PubChem CID 54041770) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is 6-(fluoromethyl)-2,3-bis[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine.
| Compound Name | 6-(fluoromethyl)-2,3-bis[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
|---|---|
| PubChem CID | 54041770 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 6-(fluoromethyl)-2,3-bis[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyridine |
| SMILES | CN1CCC[C@H]1COc1ccc(CF)nc1OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C18H28FN3O2/c1-21-9-3-5-15(21)12-23-17-8-7-14(11-19)20-18(17)24-13-16-6-4-10-22(16)2/h7-8,15-16H,3-6,9-13H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | LMWBCEPZTFAHCU-HOTGVXAUSA-N |
| XLogP | 2.50 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |