C10H20O6 — CID 54041802
(2S,3S,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexanal (PubChem CID 54041802) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexanal.
| Compound Name | (2S,3S,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexanal |
|---|---|
| PubChem CID | 54041802 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (2S,3S,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexanal |
| SMILES | COC[C@@H](O)[C@@H](OC)[C@H](OC)[C@@H](C=O)OC |
| InChI | InChI=1S/C10H20O6/c1-13-6-7(12)9(15-3)10(16-4)8(5-11)14-2/h5,7-10,12H,6H2,1-4H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | LMWNQPUYOLOJQP-ZYUZMQFOSA-N |
| XLogP | -0.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|