About 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid
2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid (PubChem CID 54042066) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid.
Molecular Properties
| Compound Name | 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid |
| PubChem CID | 54042066 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid |
| SMILES | CCCN1Nc2cccc(C(=O)O)c2S1 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-6-12-11-8-5-3-4-7(10(13)14)9(8)15-12/h3-5,11H,2,6H2,1H3,(H,13,14) |
| InChIKey | LNBBEVWOOGTWRL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid?
The IUPAC name of 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid (CID 54042066) is 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid.
What is the SMILES notation for 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid?
The canonical SMILES for 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid is CCCN1Nc2cccc(C(=O)O)c2S1.
What is the InChIKey of 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid?
The InChIKey is LNBBEVWOOGTWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-2-6-12-11-8-5-3-4-7(10(13)14)9(8)15-12/h3-5,11H,2,6H2,1H3,(H,13,14).
What are the key properties of 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid?
2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid has a molecular weight of 224.28 g/mol, XLogP of 2.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-3H-1,2,3-benzothiadiazole-7-carboxylic acid is sourced from PubChem (CID 54042066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).