C12H15NO5 — CID 54042189
6-(2-carboxyethyl)-5-oxo-2,3,6,8a-tetrahydro-1H-indolizine-3-carboxylic acid (PubChem CID 54042189) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 6-(2-carboxyethyl)-5-oxo-2,3,6,8a-tetrahydro-1H-indolizine-3-carboxylic acid.
| Compound Name | 6-(2-carboxyethyl)-5-oxo-2,3,6,8a-tetrahydro-1H-indolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 54042189 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 6-(2-carboxyethyl)-5-oxo-2,3,6,8a-tetrahydro-1H-indolizine-3-carboxylic acid |
| SMILES | O=C(O)CCC1C=CC2CCC(C(=O)O)N2C1=O |
| InChI | InChI=1S/C12H15NO5/c14-10(15)6-2-7-1-3-8-4-5-9(12(17)18)13(8)11(7)16/h1,3,7-9H,2,4-6H2,(H,14,15)(H,17,18) |
| InChIKey | LNDDNOGZIQPXKF-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|