About (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate
(2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate (PubChem CID 54042498) has the molecular formula C20H18N2O5
and a molecular weight of 366.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate |
| PubChem CID | 54042498 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)On1c(O)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O5/c23-17-11-12-18(24)22(17)27-20(26)16(13-14-7-3-1-4-8-14)21-19(25)15-9-5-2-6-10-15/h1-12,16,23-24H,13H2,(H,21,25)/t16-/m0/s1 |
| InChIKey | LNIDLWOEWDPVHM-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate (CID 54042498) is (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate is O=C(N[C@@H](Cc1ccccc1)C(=O)On1c(O)ccc1O)c1ccccc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate?
The InChIKey is LNIDLWOEWDPVHM-INIZCTEOSA-N. The full InChI is InChI=1S/C20H18N2O5/c23-17-11-12-18(24)22(17)27-20(26)16(13-14-7-3-1-4-8-14)21-19(25)15-9-5-2-6-10-15/h1-12,16,23-24H,13H2,(H,21,25)/t16-/m0/s1.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate?
(2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate has a molecular weight of 366.37 g/mol, XLogP of 1.90, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) (2S)-2-benzamido-3-phenylpropanoate is sourced from PubChem (CID 54042498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).