C13H20O4S — CID 54042645
trans-(1R,2R)-2-(3-acetylsulfanyl-2-methylpropanoyl)cyclohexane-1-carboxylic acid (PubChem CID 54042645) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-acetylsulfanyl-2-methylpropanoyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,2R)-2-(3-acetylsulfanyl-2-methylpropanoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54042645 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | trans-(1R,2R)-2-(3-acetylsulfanyl-2-methylpropanoyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)[C@@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C13H20O4S/c1-8(7-18-9(2)14)12(15)10-5-3-4-6-11(10)13(16)17/h8,10-11H,3-7H2,1-2H3,(H,16,17)/t8?,10-,11-/m1/s1 |
| InChIKey | LNKQHINVIVNFGD-GUJYYOPSSA-N |
| XLogP | 2.36 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|