C14H28N2O6S — CID 54042763
1-[4-(2-hydroxy-1-methoxypropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-1-methoxypropan-2-ol (PubChem CID 54042763) has the molecular formula C14H28N2O6S and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-[4-(2-hydroxy-1-methoxypropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-1-methoxypropan-2-ol.
| Compound Name | 1-[4-(2-hydroxy-1-methoxypropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-1-methoxypropan-2-ol |
|---|---|
| PubChem CID | 54042763 |
| Molecular Formula | C14H28N2O6S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[4-(2-hydroxy-1-methoxypropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-1-methoxypropan-2-ol |
| SMILES | COC(C(C)O)N1CCN(C(OC)C(C)O)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C14H28N2O6S/c1-9(17)13(21-3)15-5-6-16(14(22-4)10(2)18)12-8-23(19,20)7-11(12)15/h9-14,17-18H,5-8H2,1-4H3 |
| InChIKey | LNMQCHFLYISSFF-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |