About (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane
(4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane (PubChem CID 54042978) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane.
Molecular Properties
| Compound Name | (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane |
| PubChem CID | 54042978 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane |
| SMILES | C=CC(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C11H20O2/c1-6-10(2,3)9-7-8-12-11(4,5)13-9/h6,9H,1,7-8H2,2-5H3/t9-/m0/s1 |
| InChIKey | LNQNVTRFCACHKB-VIFPVBQESA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane?
The IUPAC name of (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane (CID 54042978) is (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane.
What is the SMILES notation for (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane?
The canonical SMILES for (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane is C=CC(C)(C)[C@@H]1CCOC(C)(C)O1.
What is the InChIKey of (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane?
The InChIKey is LNQNVTRFCACHKB-VIFPVBQESA-N. The full InChI is InChI=1S/C11H20O2/c1-6-10(2,3)9-7-8-12-11(4,5)13-9/h6,9H,1,7-8H2,2-5H3/t9-/m0/s1.
What are the key properties of (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane?
(4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane has a molecular weight of 184.28 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-dimethyl-4-(2-methylbut-3-en-2-yl)-1,3-dioxane is sourced from PubChem (CID 54042978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).