About 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one
17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one (PubChem CID 54043213) has the molecular formula C17H22O2
and a molecular weight of 258.36 g/mol. Its IUPAC name is 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one.
Molecular Properties
| Compound Name | 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one |
| PubChem CID | 54043213 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one |
| SMILES | CCCC(=O)CCC=CC=CC#CC#CCCCO |
| InChI | InChI=1S/C17H22O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10,18H,2,11-16H2,1H3 |
| InChIKey | LNUGFLAFCOXHNN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one?
The IUPAC name of 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one (CID 54043213) is 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one.
What is the SMILES notation for 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one?
The canonical SMILES for 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one is CCCC(=O)CCC=CC=CC#CC#CCCCO.
What is the InChIKey of 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one?
The InChIKey is LNUGFLAFCOXHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10,18H,2,11-16H2,1H3.
What are the key properties of 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one?
17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one has a molecular weight of 258.36 g/mol, XLogP of 3.03, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 17-hydroxyheptadeca-7,9-dien-11,13-diyn-4-one is sourced from PubChem (CID 54043213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).