C16H11Cl2NO3 — CID 54043432
2-[1-(2,6-dichlorophenyl)ethoxy]isoindole-1,3-dione (PubChem CID 54043432) has the molecular formula C16H11Cl2NO3 and a molecular weight of 336.17 g/mol. Its IUPAC name is 2-[1-(2,6-dichlorophenyl)ethoxy]isoindole-1,3-dione.
| Compound Name | 2-[1-(2,6-dichlorophenyl)ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54043432 |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-[1-(2,6-dichlorophenyl)ethoxy]isoindole-1,3-dione |
| SMILES | CC(ON1C(=O)c2ccccc2C1=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H11Cl2NO3/c1-9(14-12(17)7-4-8-13(14)18)22-19-15(20)10-5-2-3-6-11(10)16(19)21/h2-9H,1H3 |
| InChIKey | LNXWQDFPSRRGPS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|