About [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate
[1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate (PubChem CID 54043578) has the molecular formula C14H17Cl2N3O3
and a molecular weight of 346.21 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate |
| PubChem CID | 54043578 |
| Molecular Formula | C14H17Cl2N3O3 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(c2cc(Cl)nc(Cl)c2)C1=O |
| InChI | InChI=1S/C14H17Cl2N3O3/c1-14(2,3)18-13(21)22-9-4-5-19(12(9)20)8-6-10(15)17-11(16)7-8/h6-7,9H,4-5H2,1-3H3,(H,18,21) |
| InChIKey | LOAIEQVVXJUKOP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate?
The IUPAC name of [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate (CID 54043578) is [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate.
What is the SMILES notation for [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate?
The canonical SMILES for [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCN(c2cc(Cl)nc(Cl)c2)C1=O.
What is the InChIKey of [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate?
The InChIKey is LOAIEQVVXJUKOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O3/c1-14(2,3)18-13(21)22-9-4-5-19(12(9)20)8-6-10(15)17-11(16)7-8/h6-7,9H,4-5H2,1-3H3,(H,18,21).
What are the key properties of [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate?
[1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate has a molecular weight of 346.21 g/mol, XLogP of 3.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,6-dichloro-4-pyridinyl)-2-oxopyrrolidin-3-yl] N-tert-butylcarbamate is sourced from PubChem (CID 54043578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).