C11H18Br6ClO3P — CID 54044411
1,1,3-tribromo-1-[chloromethyl-(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl]oxy-2,2-dimethylpropane (PubChem CID 54044411) has the molecular formula C11H18Br6ClO3P and a molecular weight of 744.11 g/mol. Its IUPAC name is 1,1,3-tribromo-1-[chloromethyl-(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl]oxy-2,2-dimethylpropane.
| Compound Name | 1,1,3-tribromo-1-[chloromethyl-(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl]oxy-2,2-dimethylpropane |
|---|---|
| PubChem CID | 54044411 |
| Molecular Formula | C11H18Br6ClO3P |
| Molecular Weight | 744.11 g/mol |
| Exact Mass | 737.58 |
| IUPAC Name | 1,1,3-tribromo-1-[chloromethyl-(1,1,3-tribromo-2,2-dimethylpropoxy)phosphoryl]oxy-2,2-dimethylpropane |
| SMILES | CC(C)(CBr)C(Br)(Br)OP(=O)(CCl)OC(Br)(Br)C(C)(C)CBr |
| InChI | InChI=1S/C11H18Br6ClO3P/c1-8(2,5-12)10(14,15)20-22(19,7-18)21-11(16,17)9(3,4)6-13/h5-7H2,1-4H3 |
| InChIKey | LONXTPMXVCMHCK-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.11 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|