C21H32Si — CID 54044646
2,4,5,6,7,8-hexahydroazulen-2-yl-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 54044646) has the molecular formula C21H32Si and a molecular weight of 312.57 g/mol. Its IUPAC name is 2,4,5,6,7,8-hexahydroazulen-2-yl-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | 2,4,5,6,7,8-hexahydroazulen-2-yl-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 54044646 |
| Molecular Formula | C21H32Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2,4,5,6,7,8-hexahydroazulen-2-yl-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(C)C2C=C3CCCCCC3=C2)C(C)=C1C |
| InChI | InChI=1S/C21H32Si/c1-14-15(2)17(4)21(16(14)3)22(5,6)20-12-18-10-8-7-9-11-19(18)13-20/h12-13,20-21H,7-11H2,1-6H3 |
| InChIKey | LOSGDKHVQFYGTQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|