C17H19ClO2 — CID 54045031
5-(6-chloro-4,7-dimethyl-2,3-dihydro-1H-inden-5-yl)cyclohexane-1,3-dione (PubChem CID 54045031) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is 5-(6-chloro-4,7-dimethyl-2,3-dihydro-1H-inden-5-yl)cyclohexane-1,3-dione.
| Compound Name | 5-(6-chloro-4,7-dimethyl-2,3-dihydro-1H-inden-5-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54045031 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 5-(6-chloro-4,7-dimethyl-2,3-dihydro-1H-inden-5-yl)cyclohexane-1,3-dione |
| SMILES | Cc1c(Cl)c(C2CC(=O)CC(=O)C2)c(C)c2c1CCC2 |
| InChI | InChI=1S/C17H19ClO2/c1-9-14-4-3-5-15(14)10(2)17(18)16(9)11-6-12(19)8-13(20)7-11/h11H,3-8H2,1-2H3 |
| InChIKey | LOYMTCOCJJKEDJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|