C19H36ClN — CID 54045076
11-chloro-N,N-diethyl-3,7,11-trimethyldodeca-2,4-dien-1-amine (PubChem CID 54045076) has the molecular formula C19H36ClN and a molecular weight of 313.96 g/mol. Its IUPAC name is 11-chloro-N,N-diethyl-3,7,11-trimethyldodeca-2,4-dien-1-amine.
| Compound Name | 11-chloro-N,N-diethyl-3,7,11-trimethyldodeca-2,4-dien-1-amine |
|---|---|
| PubChem CID | 54045076 |
| Molecular Formula | C19H36ClN |
| Molecular Weight | 313.96 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 11-chloro-N,N-diethyl-3,7,11-trimethyldodeca-2,4-dien-1-amine |
| SMILES | CCN(CC)CC=C(C)C=CCC(C)CCCC(C)(C)Cl |
| InChI | InChI=1S/C19H36ClN/c1-7-21(8-2)16-14-18(4)12-9-11-17(3)13-10-15-19(5,6)20/h9,12,14,17H,7-8,10-11,13,15-16H2,1-6H3 |
| InChIKey | LOYZAWCJQQUEAB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|